C14H24O — CID 10727086
(4aS,8aS)-6-tert-butyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-ol (PubChem CID 10727086) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (4aS,8aS)-6-tert-butyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-ol.
| Compound Name | (4aS,8aS)-6-tert-butyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 10727086 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (4aS,8aS)-6-tert-butyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-ol |
| SMILES | CC(C)(C)C1=CC[C@@H]2CCCC[C@]2(O)C1 |
| InChI | InChI=1S/C14H24O/c1-13(2,3)12-8-7-11-6-4-5-9-14(11,15)10-12/h8,11,15H,4-7,9-10H2,1-3H3/t11-,14-/m0/s1 |
| InChIKey | VIHLOWATSWFVMI-FZMZJTMJSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|