C14H20O2 — CID 6558361
(2aS,4aR,8aS)-2,2,4a-trimethyl-1,2a,3,4,6,7-hexahydrocyclobuta[i]indene-5,8-dione (PubChem CID 6558361) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (2aS,4aR,8aS)-2,2,4a-trimethyl-1,2a,3,4,6,7-hexahydrocyclobuta[i]indene-5,8-dione.
| Compound Name | (2aS,4aR,8aS)-2,2,4a-trimethyl-1,2a,3,4,6,7-hexahydrocyclobuta[i]indene-5,8-dione |
|---|---|
| PubChem CID | 6558361 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2aS,4aR,8aS)-2,2,4a-trimethyl-1,2a,3,4,6,7-hexahydrocyclobuta[i]indene-5,8-dione |
| SMILES | CC1(C)C[C@@]23C(=O)CCC(=O)[C@]2(C)CC[C@@H]13 |
| InChI | InChI=1S/C14H20O2/c1-12(2)8-14-9(12)6-7-13(14,3)10(15)4-5-11(14)16/h9H,4-8H2,1-3H3/t9-,13-,14+/m0/s1 |
| InChIKey | PLFWLYJWPAOEIB-QCZZGDTMSA-N |
| XLogP | 2.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |