C9H12O2 — CID 130906162
(1S,6R)-1-methylbicyclo[4.2.0]octane-2,5-dione (PubChem CID 130906162) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1S,6R)-1-methylbicyclo[4.2.0]octane-2,5-dione.
| Compound Name | (1S,6R)-1-methylbicyclo[4.2.0]octane-2,5-dione |
|---|---|
| PubChem CID | 130906162 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1S,6R)-1-methylbicyclo[4.2.0]octane-2,5-dione |
| SMILES | C[C@]12CC[C@H]1C(=O)CCC2=O |
| InChI | InChI=1S/C9H12O2/c1-9-5-4-6(9)7(10)2-3-8(9)11/h6H,2-5H2,1H3/t6-,9-/m0/s1 |
| InChIKey | UMJOTSOXLNWHTM-RCOVLWMOSA-N |
| XLogP | 1.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |