C13H20O — CID 14759938
(2aR,5aR,9aS)-5a-methyl-2,2a,4,5,6,7,8,9-octahydro-1H-cyclobuta[j]naphthalen-3-one (PubChem CID 14759938) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (2aR,5aR,9aS)-5a-methyl-2,2a,4,5,6,7,8,9-octahydro-1H-cyclobuta[j]naphthalen-3-one.
| Compound Name | (2aR,5aR,9aS)-5a-methyl-2,2a,4,5,6,7,8,9-octahydro-1H-cyclobuta[j]naphthalen-3-one |
|---|---|
| PubChem CID | 14759938 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2aR,5aR,9aS)-5a-methyl-2,2a,4,5,6,7,8,9-octahydro-1H-cyclobuta[j]naphthalen-3-one |
| SMILES | C[C@]12CCCC[C@@]13CC[C@H]3C(=O)CC2 |
| InChI | InChI=1S/C13H20O/c1-12-6-2-3-7-13(12)9-4-10(13)11(14)5-8-12/h10H,2-9H2,1H3/t10-,12+,13-/m0/s1 |
| InChIKey | KMYPITFAVGHJCD-UHTWSYAYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |