C13H17NO2 — CID 10536868
(6aS)-6a-methyl-1,2,4,5,6,8,9,9a-octahydrocyclopenta[f]quinoline-3,7-dione (PubChem CID 10536868) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (6aS)-6a-methyl-1,2,4,5,6,8,9,9a-octahydrocyclopenta[f]quinoline-3,7-dione.
| Compound Name | (6aS)-6a-methyl-1,2,4,5,6,8,9,9a-octahydrocyclopenta[f]quinoline-3,7-dione |
|---|---|
| PubChem CID | 10536868 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (6aS)-6a-methyl-1,2,4,5,6,8,9,9a-octahydrocyclopenta[f]quinoline-3,7-dione |
| SMILES | C[C@]12CCC3=C(CCC(=O)N3)C1CCC2=O |
| InChI | InChI=1S/C13H17NO2/c1-13-7-6-10-8(2-5-12(16)14-10)9(13)3-4-11(13)15/h9H,2-7H2,1H3,(H,14,16)/t9?,13-/m0/s1 |
| InChIKey | MAGJNSIKLCLXAO-NCWAPJAISA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |