C24H37NO3Si — CID 67671329
(3aS,9aR,9bR,11aS)-4-[butyl(dimethyl)silyl]oxy-9a,11a-dimethyl-3,3a,6,8,9,9b,10,11-octahydro-2H-indeno[5,4-f]quinoline-1,7-dione (PubChem CID 67671329) has the molecular formula C24H37NO3Si and a molecular weight of 415.65 g/mol. Its IUPAC name is (3aS,9aR,9bR,11aS)-4-[butyl(dimethyl)silyl]oxy-9a,11a-dimethyl-3,3a,6,8,9,9b,10,11-octahydro-2H-indeno[5,4-f]quinoline-1,7-dione.
| Compound Name | (3aS,9aR,9bR,11aS)-4-[butyl(dimethyl)silyl]oxy-9a,11a-dimethyl-3,3a,6,8,9,9b,10,11-octahydro-2H-indeno[5,4-f]quinoline-1,7-dione |
|---|---|
| PubChem CID | 67671329 |
| Molecular Formula | C24H37NO3Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (3aS,9aR,9bR,11aS)-4-[butyl(dimethyl)silyl]oxy-9a,11a-dimethyl-3,3a,6,8,9,9b,10,11-octahydro-2H-indeno[5,4-f]quinoline-1,7-dione |
| SMILES | CCCC[Si](C)(C)OC1=C2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)CCC(=O)NC2=C1 |
| InChI | InChI=1S/C24H37NO3Si/c1-6-7-14-29(4,5)28-18-15-19-23(2,13-11-21(27)25-19)17-10-12-24(3)16(22(17)18)8-9-20(24)26/h15-17H,6-14H2,1-5H3,(H,25,27)/t16-,17-,23+,24-/m0/s1 |
| InChIKey | MWRLFPOWWVFICW-FFLGGZPMSA-N |
| XLogP | 5.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|