C25H36O4 — CID 10092407
[(6S,10R,13S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-6-yl] hexanoate (PubChem CID 10092407) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [(6S,10R,13S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-6-yl] hexanoate.
| Compound Name | [(6S,10R,13S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-6-yl] hexanoate |
|---|---|
| PubChem CID | 10092407 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(6S,10R,13S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-6-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1CC2C(CC[C@]3(C)C(=O)CCC23)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C25H36O4/c1-4-5-6-7-23(28)29-21-15-17-18-8-9-22(27)25(18,3)13-11-19(17)24(2)12-10-16(26)14-20(21)24/h14,17-19,21H,4-13,15H2,1-3H3/t17?,18?,19?,21-,24+,25-/m0/s1 |
| InChIKey | AMIDPDOKRBRJTC-SOYJQDOISA-N |
| XLogP | 5.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|