C27H38O4 — CID 101076365
[(6S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] octanoate (PubChem CID 101076365) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is [(6S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] octanoate.
| Compound Name | [(6S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] octanoate |
|---|---|
| PubChem CID | 101076365 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | [(6S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C27H38O4/c1-4-5-6-7-8-9-25(30)31-23-17-19-20-10-11-24(29)27(20,3)15-13-21(19)26(2)14-12-18(28)16-22(23)26/h12,14,16,19-21,23H,4-11,13,15,17H2,1-3H3/t19-,20-,21-,23-,26+,27-/m0/s1 |
| InChIKey | UDKVVPVXLGBDOQ-DKAWINOHSA-N |
| XLogP | 5.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|