C24H42O2Si — CID 22295559
(3R,5S,8R,9S,10S,13S,14S)-3-[dimethyl(propyl)silyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 22295559) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S)-3-[dimethyl(propyl)silyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S)-3-[dimethyl(propyl)silyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 22295559 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S)-3-[dimethyl(propyl)silyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CCC[Si](C)(C)O[C@@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C24H42O2Si/c1-6-15-27(4,5)26-18-11-13-23(2)17(16-18)7-8-19-20-9-10-22(25)24(20,3)14-12-21(19)23/h17-21H,6-16H2,1-5H3/t17-,18+,19-,20-,21-,23-,24-/m0/s1 |
| InChIKey | NWBFGNHOLZDBBM-PRLAPGDWSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|