C15H22O2 — CID 22794202
(6aR,9aS)-3-ethyl-6a-methyl-1,2,3,5,6,8,9,9a-octahydrocyclopenta[f]chromen-7-one (PubChem CID 22794202) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (6aR,9aS)-3-ethyl-6a-methyl-1,2,3,5,6,8,9,9a-octahydrocyclopenta[f]chromen-7-one.
| Compound Name | (6aR,9aS)-3-ethyl-6a-methyl-1,2,3,5,6,8,9,9a-octahydrocyclopenta[f]chromen-7-one |
|---|---|
| PubChem CID | 22794202 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (6aR,9aS)-3-ethyl-6a-methyl-1,2,3,5,6,8,9,9a-octahydrocyclopenta[f]chromen-7-one |
| SMILES | CCC1CCC2=C(CC[C@@]3(C)C(=O)CC[C@@H]23)O1 |
| InChI | InChI=1S/C15H22O2/c1-3-10-4-5-11-12-6-7-14(16)15(12,2)9-8-13(11)17-10/h10,12H,3-9H2,1-2H3/t10?,12-,15+/m0/s1 |
| InChIKey | SGFFBYPDCOGEMM-PMPKIWSKSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |