About acetonitrile;5-ethyloxolan-2-one
acetonitrile;5-ethyloxolan-2-one (PubChem CID 174800937) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is acetonitrile;5-ethyloxolan-2-one.
Molecular Properties
| Compound Name | acetonitrile;5-ethyloxolan-2-one |
| PubChem CID | 174800937 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | acetonitrile;5-ethyloxolan-2-one |
| SMILES | CC#N.CCC1CCC(=O)O1 |
| InChI | InChI=1S/C6H10O2.C2H3N/c1-2-5-3-4-6(7)8-5;1-2-3/h5H,2-4H2,1H3;1H3 |
| InChIKey | OABKTWFKYXSDMY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;5-ethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;5-ethyloxolan-2-one?
The IUPAC name of acetonitrile;5-ethyloxolan-2-one (CID 174800937) is acetonitrile;5-ethyloxolan-2-one.
What is the SMILES notation for acetonitrile;5-ethyloxolan-2-one?
The canonical SMILES for acetonitrile;5-ethyloxolan-2-one is CC#N.CCC1CCC(=O)O1.
What is the InChIKey of acetonitrile;5-ethyloxolan-2-one?
The InChIKey is OABKTWFKYXSDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C2H3N/c1-2-5-3-4-6(7)8-5;1-2-3/h5H,2-4H2,1H3;1H3.
What are the key properties of acetonitrile;5-ethyloxolan-2-one?
acetonitrile;5-ethyloxolan-2-one has a molecular weight of 155.20 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;5-ethyloxolan-2-one is sourced from PubChem (CID 174800937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).