C16H26O2 — CID 22794198
(6aR,9aR)-3,6a-diethyl-2,3,5,6,7,8,9,9a-octahydro-1H-cyclopenta[f]chromen-7-ol (PubChem CID 22794198) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (6aR,9aR)-3,6a-diethyl-2,3,5,6,7,8,9,9a-octahydro-1H-cyclopenta[f]chromen-7-ol.
| Compound Name | (6aR,9aR)-3,6a-diethyl-2,3,5,6,7,8,9,9a-octahydro-1H-cyclopenta[f]chromen-7-ol |
|---|---|
| PubChem CID | 22794198 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (6aR,9aR)-3,6a-diethyl-2,3,5,6,7,8,9,9a-octahydro-1H-cyclopenta[f]chromen-7-ol |
| SMILES | CCC1CCC2=C(CC[C@@]3(CC)C(O)CC[C@@H]23)O1 |
| InChI | InChI=1S/C16H26O2/c1-3-11-5-6-12-13-7-8-15(17)16(13,4-2)10-9-14(12)18-11/h11,13,15,17H,3-10H2,1-2H3/t11?,13-,15?,16+/m0/s1 |
| InChIKey | UTNCFIGJTMEXCA-PBYBEEADSA-N |
| XLogP | 3.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |