C6H12O2 — CID 102159302
cis-(1S,2R)-1-ethylcyclobutane-1,2-diol (PubChem CID 102159302) has the molecular formula C6H12O2 and a molecular weight of 116.16 g/mol. Its IUPAC name is cis-(1S,2R)-1-ethylcyclobutane-1,2-diol.
| Compound Name | cis-(1S,2R)-1-ethylcyclobutane-1,2-diol |
|---|---|
| PubChem CID | 102159302 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | cis-(1S,2R)-1-ethylcyclobutane-1,2-diol |
| SMILES | CC[C@]1(O)CC[C@H]1O |
| InChI | InChI=1S/C6H12O2/c1-2-6(8)4-3-5(6)7/h5,7-8H,2-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | UGAHNVIDTRHGNO-RITPCOANSA-N |
| XLogP | 0.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |