C21H32O3 — CID 101387508
[(3aS,7aS)-6,6,7a-trimethyl-3-(2-methyl-5-oxohex-1-enylidene)-1,2,3a,4,5,7-hexahydroinden-2-yl] acetate (PubChem CID 101387508) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [(3aS,7aS)-6,6,7a-trimethyl-3-(2-methyl-5-oxohex-1-enylidene)-1,2,3a,4,5,7-hexahydroinden-2-yl] acetate.
| Compound Name | [(3aS,7aS)-6,6,7a-trimethyl-3-(2-methyl-5-oxohex-1-enylidene)-1,2,3a,4,5,7-hexahydroinden-2-yl] acetate |
|---|---|
| PubChem CID | 101387508 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(3aS,7aS)-6,6,7a-trimethyl-3-(2-methyl-5-oxohex-1-enylidene)-1,2,3a,4,5,7-hexahydroinden-2-yl] acetate |
| SMILES | CC(=O)CCC(C)=C=C1C(OC(C)=O)C[C@]2(C)CC(C)(C)CC[C@H]12 |
| InChI | InChI=1S/C21H32O3/c1-14(7-8-15(2)22)11-17-18-9-10-20(4,5)13-21(18,6)12-19(17)24-16(3)23/h18-19H,7-10,12-13H2,1-6H3/t11?,18-,19?,21-/m1/s1 |
| InChIKey | LZIXUZXNFVGNOG-KWNONLQXSA-N |
| XLogP | 5.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |