C15H27O4- — CID 57359530
2-(5-butyl-5-ethyl-2-methyl-1,3-dioxan-2-yl)butanoate (PubChem CID 57359530) has the molecular formula C15H27O4- and a molecular weight of 271.38 g/mol. Its IUPAC name is 2-(5-butyl-5-ethyl-2-methyl-1,3-dioxan-2-yl)butanoate.
| Compound Name | 2-(5-butyl-5-ethyl-2-methyl-1,3-dioxan-2-yl)butanoate |
|---|---|
| PubChem CID | 57359530 |
| Molecular Formula | C15H27O4- |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-(5-butyl-5-ethyl-2-methyl-1,3-dioxan-2-yl)butanoate |
| SMILES | CCCCC1(CC)COC(C)(C(CC)C(=O)[O-])OC1 |
| InChI | InChI=1S/C15H28O4/c1-5-8-9-15(7-3)10-18-14(4,19-11-15)12(6-2)13(16)17/h12H,5-11H2,1-4H3,(H,16,17)/p-1 |
| InChIKey | SSNFDEPJYFWCFP-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |