C14H27O4P — CID 23002154
1-(5-butyl-5-ethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 23002154) has the molecular formula C14H27O4P and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-(5-butyl-5-ethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(5-butyl-5-ethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 23002154 |
| Molecular Formula | C14H27O4P |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-(5-butyl-5-ethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | CCCCC1(CC)COP(=O)(C(=O)C(C)(C)C)OC1 |
| InChI | InChI=1S/C14H27O4P/c1-6-8-9-14(7-2)10-17-19(16,18-11-14)12(15)13(3,4)5/h6-11H2,1-5H3 |
| InChIKey | JRHLVMOTPHZSHI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|