C8H15O4P — CID 141060465
1-(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)pentan-1-one (PubChem CID 141060465) has the molecular formula C8H15O4P and a molecular weight of 206.18 g/mol. Its IUPAC name is 1-(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)pentan-1-one.
| Compound Name | 1-(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 141060465 |
| Molecular Formula | C8H15O4P |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 1-(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)pentan-1-one |
| SMILES | CCCCC(=O)P1(=O)OCCCO1 |
| InChI | InChI=1S/C8H15O4P/c1-2-3-5-8(9)13(10)11-6-4-7-12-13/h2-7H2,1H3 |
| InChIKey | XEDCABPXUNUTDK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|