C7H15O3P — CID 14872336
2-butan-2-yl-1,3,2lambda5-dioxaphosphinane 2-oxide (PubChem CID 14872336) has the molecular formula C7H15O3P and a molecular weight of 178.17 g/mol. Its IUPAC name is 2-butan-2-yl-1,3,2lambda5-dioxaphosphinane 2-oxide.
| Compound Name | 2-butan-2-yl-1,3,2lambda5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 14872336 |
| Molecular Formula | C7H15O3P |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-butan-2-yl-1,3,2lambda5-dioxaphosphinane 2-oxide |
| SMILES | CCC(C)P1(=O)OCCCO1 |
| InChI | InChI=1S/C7H15O3P/c1-3-7(2)11(8)9-5-4-6-10-11/h7H,3-6H2,1-2H3 |
| InChIKey | HLWBCKXMSMHEKS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|