C10H18O3 — CID 130457394
2-methyl-1-(2-methyl-1,3-dioxan-2-yl)butan-1-one (PubChem CID 130457394) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-1,3-dioxan-2-yl)butan-1-one.
| Compound Name | 2-methyl-1-(2-methyl-1,3-dioxan-2-yl)butan-1-one |
|---|---|
| PubChem CID | 130457394 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-methyl-1-(2-methyl-1,3-dioxan-2-yl)butan-1-one |
| SMILES | CCC(C)C(=O)C1(C)OCCCO1 |
| InChI | InChI=1S/C10H18O3/c1-4-8(2)9(11)10(3)12-6-5-7-13-10/h8H,4-7H2,1-3H3 |
| InChIKey | HJUOHAATVQOMKQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |