About 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone
2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone (PubChem CID 21471052) has the molecular formula C6H8Cl2O3
and a molecular weight of 199.03 g/mol. Its IUPAC name is 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone.
Molecular Properties
| Compound Name | 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone |
| PubChem CID | 21471052 |
| Molecular Formula | C6H8Cl2O3 |
| Molecular Weight | 199.03 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone |
| SMILES | CC1(C(=O)C(Cl)Cl)OCCO1 |
| InChI | InChI=1S/C6H8Cl2O3/c1-6(4(9)5(7)8)10-2-3-11-6/h5H,2-3H2,1H3 |
| InChIKey | CULJXTZIESQGOB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.03 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone?
The IUPAC name of 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone (CID 21471052) is 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone.
What is the SMILES notation for 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone?
The canonical SMILES for 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone is CC1(C(=O)C(Cl)Cl)OCCO1.
What is the InChIKey of 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone?
The InChIKey is CULJXTZIESQGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2O3/c1-6(4(9)5(7)8)10-2-3-11-6/h5H,2-3H2,1H3.
What are the key properties of 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone?
2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone has a molecular weight of 199.03 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone is sourced from PubChem (CID 21471052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).