C6H8Cl2O3 — CID 21471052
2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone (PubChem CID 21471052) has the molecular formula C6H8Cl2O3 and a molecular weight of 199.03 g/mol. Its IUPAC name is 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone.
| Compound Name | 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone |
|---|---|
| PubChem CID | 21471052 |
| Molecular Formula | C6H8Cl2O3 |
| Molecular Weight | 199.03 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 2,2-dichloro-1-(2-methyl-1,3-dioxolan-2-yl)ethanone |
| SMILES | CC1(C(=O)C(Cl)Cl)OCCO1 |
| InChI | InChI=1S/C6H8Cl2O3/c1-6(4(9)5(7)8)10-2-3-11-6/h5H,2-3H2,1H3 |
| InChIKey | CULJXTZIESQGOB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.03 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|