C7H13NO3 — CID 117273611
1-amino-1-(2-methyl-1,3-dioxolan-2-yl)propan-2-one (PubChem CID 117273611) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is 1-amino-1-(2-methyl-1,3-dioxolan-2-yl)propan-2-one.
| Compound Name | 1-amino-1-(2-methyl-1,3-dioxolan-2-yl)propan-2-one |
|---|---|
| PubChem CID | 117273611 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1-amino-1-(2-methyl-1,3-dioxolan-2-yl)propan-2-one |
| SMILES | CC(=O)C(N)C1(C)OCCO1 |
| InChI | InChI=1S/C7H13NO3/c1-5(9)6(8)7(2)10-3-4-11-7/h6H,3-4,8H2,1-2H3 |
| InChIKey | WUEYRSQCMFJEOO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |