C13H21NO3 — CID 70658479
2-(2-methyl-1,3-dioxolan-2-yl)-1-pyrrolidin-1-ylpent-4-en-1-one (PubChem CID 70658479) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dioxolan-2-yl)-1-pyrrolidin-1-ylpent-4-en-1-one.
| Compound Name | 2-(2-methyl-1,3-dioxolan-2-yl)-1-pyrrolidin-1-ylpent-4-en-1-one |
|---|---|
| PubChem CID | 70658479 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-(2-methyl-1,3-dioxolan-2-yl)-1-pyrrolidin-1-ylpent-4-en-1-one |
| SMILES | C=CCC(C(=O)N1CCCC1)C1(C)OCCO1 |
| InChI | InChI=1S/C13H21NO3/c1-3-6-11(13(2)16-9-10-17-13)12(15)14-7-4-5-8-14/h3,11H,1,4-10H2,2H3 |
| InChIKey | BKIQPXJYJPAOBK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|