C8H16O3 — CID 59735081
2-(2-methyl-1,3-dioxolan-2-yl)butan-1-ol (PubChem CID 59735081) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dioxolan-2-yl)butan-1-ol.
| Compound Name | 2-(2-methyl-1,3-dioxolan-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 59735081 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 2-(2-methyl-1,3-dioxolan-2-yl)butan-1-ol |
| SMILES | CCC(CO)C1(C)OCCO1 |
| InChI | InChI=1S/C8H16O3/c1-3-7(6-9)8(2)10-4-5-11-8/h7,9H,3-6H2,1-2H3 |
| InChIKey | MWEHUBNWYSFXSI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |