C11H22O2 — CID 90807510
2-methyl-2-(5-methylhexan-2-yl)-1,3-dioxolane (PubChem CID 90807510) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-methyl-2-(5-methylhexan-2-yl)-1,3-dioxolane.
| Compound Name | 2-methyl-2-(5-methylhexan-2-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 90807510 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-methyl-2-(5-methylhexan-2-yl)-1,3-dioxolane |
| SMILES | CC(C)CCC(C)C1(C)OCCO1 |
| InChI | InChI=1S/C11H22O2/c1-9(2)5-6-10(3)11(4)12-7-8-13-11/h9-10H,5-8H2,1-4H3 |
| InChIKey | QGYGUADGXLPMED-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |