C10H20O2 — CID 13315713
2-methyl-2-(3-methylpentyl)-1,3-dioxolane (PubChem CID 13315713) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-methyl-2-(3-methylpentyl)-1,3-dioxolane.
| Compound Name | 2-methyl-2-(3-methylpentyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 13315713 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2-methyl-2-(3-methylpentyl)-1,3-dioxolane |
| SMILES | CCC(C)CCC1(C)OCCO1 |
| InChI | InChI=1S/C10H20O2/c1-4-9(2)5-6-10(3)11-7-8-12-10/h9H,4-8H2,1-3H3 |
| InChIKey | ZIAGRLZKIFNWOA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |