C10H19IO2 — CID 10990159
2-[(2R)-5-iodo-2-methylpentyl]-2-methyl-1,3-dioxolane (PubChem CID 10990159) has the molecular formula C10H19IO2 and a molecular weight of 298.16 g/mol. Its IUPAC name is 2-[(2R)-5-iodo-2-methylpentyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[(2R)-5-iodo-2-methylpentyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10990159 |
| Molecular Formula | C10H19IO2 |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-[(2R)-5-iodo-2-methylpentyl]-2-methyl-1,3-dioxolane |
| SMILES | C[C@H](CCCI)CC1(C)OCCO1 |
| InChI | InChI=1S/C10H19IO2/c1-9(4-3-5-11)8-10(2)12-6-7-13-10/h9H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | UXWJOWPHNZEQLH-SECBINFHSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|