C15H28O5 — CID 10401850
methyl (3R,8R)-3-hydroxy-8-methyl-9-(2-methyl-1,3-dioxolan-2-yl)nonanoate (PubChem CID 10401850) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is methyl (3R,8R)-3-hydroxy-8-methyl-9-(2-methyl-1,3-dioxolan-2-yl)nonanoate.
| Compound Name | methyl (3R,8R)-3-hydroxy-8-methyl-9-(2-methyl-1,3-dioxolan-2-yl)nonanoate |
|---|---|
| PubChem CID | 10401850 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | methyl (3R,8R)-3-hydroxy-8-methyl-9-(2-methyl-1,3-dioxolan-2-yl)nonanoate |
| SMILES | COC(=O)C[C@H](O)CCCC[C@@H](C)CC1(C)OCCO1 |
| InChI | InChI=1S/C15H28O5/c1-12(11-15(2)19-8-9-20-15)6-4-5-7-13(16)10-14(17)18-3/h12-13,16H,4-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | ULDKFIBLCZFFKY-CHWSQXEVSA-N |
| XLogP | 2.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|