About 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol
2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol (PubChem CID 86098194) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol.
Analyze 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol?
The IUPAC name of 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol (CID 86098194) is 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol.
What is the SMILES notation for 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol?
The canonical SMILES for 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol is CC1(CC(CO)CO)OCCO1.
What is the InChIKey of 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol?
The InChIKey is OAZYGGWRLGTSMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-8(11-2-3-12-8)4-7(5-9)6-10/h7,9-10H,2-6H2,1H3.
What are the key properties of 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol?
2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol has a molecular weight of 176.21 g/mol, XLogP of -0.26, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-1,3-dioxolan-2-yl)methyl]propane-1,3-diol is sourced from PubChem (CID 86098194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).