C8H14O3Se — CID 13496983
Se-methyl 3-(2-methyl-1,3-dioxolan-2-yl)propaneselenoate (PubChem CID 13496983) has the molecular formula C8H14O3Se and a molecular weight of 237.16 g/mol. Its IUPAC name is Se-methyl 3-(2-methyl-1,3-dioxolan-2-yl)propaneselenoate.
| Compound Name | Se-methyl 3-(2-methyl-1,3-dioxolan-2-yl)propaneselenoate |
|---|---|
| PubChem CID | 13496983 |
| Molecular Formula | C8H14O3Se |
| Molecular Weight | 237.16 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | Se-methyl 3-(2-methyl-1,3-dioxolan-2-yl)propaneselenoate |
| SMILES | C[Se]C(=O)CCC1(C)OCCO1 |
| InChI | InChI=1S/C8H14O3Se/c1-8(10-5-6-11-8)4-3-7(9)12-2/h3-6H2,1-2H3 |
| InChIKey | VVYLWCTYRIKYST-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|