C9H15N2O4+ — CID 20831968
(E)-imino-[1-methoxy-4-(2-methyl-1,3-dioxolan-2-yl)-1-oxobutan-2-ylidene]azanium (PubChem CID 20831968) has the molecular formula C9H15N2O4+ and a molecular weight of 215.23 g/mol. Its IUPAC name is (E)-imino-[1-methoxy-4-(2-methyl-1,3-dioxolan-2-yl)-1-oxobutan-2-ylidene]azanium.
| Compound Name | (E)-imino-[1-methoxy-4-(2-methyl-1,3-dioxolan-2-yl)-1-oxobutan-2-ylidene]azanium |
|---|---|
| PubChem CID | 20831968 |
| Molecular Formula | C9H15N2O4+ |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | (E)-imino-[1-methoxy-4-(2-methyl-1,3-dioxolan-2-yl)-1-oxobutan-2-ylidene]azanium |
| SMILES | COC(=O)C(CCC1(C)OCCO1)=[N+]=N |
| InChI | InChI=1S/C9H15N2O4/c1-9(14-5-6-15-9)4-3-7(11-10)8(12)13-2/h10H,3-6H2,1-2H3/q+1 |
| InChIKey | QPMZGQWPXBOSRM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|