About methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate
methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate (PubChem CID 57358884) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate.
Analyze methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate?
The IUPAC name of methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate (CID 57358884) is methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate.
What is the SMILES notation for methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate?
The canonical SMILES for methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate is COC(=O)NCCC1(C)OCCO1.
What is the InChIKey of methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate?
The InChIKey is IMKYHVVZZCURNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4/c1-8(12-5-6-13-8)3-4-9-7(10)11-2/h3-6H2,1-2H3,(H,9,10).
What are the key properties of methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate?
methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate has a molecular weight of 189.21 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]carbamate is sourced from PubChem (CID 57358884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).