C11H15NO4 — CID 110359265
N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]furan-2-carboxamide (PubChem CID 110359265) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110359265 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]furan-2-carboxamide |
| SMILES | CC1(CCNC(=O)c2ccco2)OCCO1 |
| InChI | InChI=1S/C11H15NO4/c1-11(15-7-8-16-11)4-5-12-10(13)9-3-2-6-14-9/h2-3,6H,4-5,7-8H2,1H3,(H,12,13) |
| InChIKey | YRNYVLZCRUFMCE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |