C10H20N2O3 — CID 110359336
1-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3-propylurea (PubChem CID 110359336) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3-propylurea.
| Compound Name | 1-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3-propylurea |
|---|---|
| PubChem CID | 110359336 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3-propylurea |
| SMILES | CCCNC(=O)NCCC1(C)OCCO1 |
| InChI | InChI=1S/C10H20N2O3/c1-3-5-11-9(13)12-6-4-10(2)14-7-8-15-10/h3-8H2,1-2H3,(H2,11,12,13) |
| InChIKey | FMMWIFPBHXXLLL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |