C18H32O6 — CID 161106627
5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one;2-methyl-4-(2-methyl-1,3-dioxolan-2-yl)butanal (PubChem CID 161106627) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is 5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one;2-methyl-4-(2-methyl-1,3-dioxolan-2-yl)butanal.
| Compound Name | 5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one;2-methyl-4-(2-methyl-1,3-dioxolan-2-yl)butanal |
|---|---|
| PubChem CID | 161106627 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one;2-methyl-4-(2-methyl-1,3-dioxolan-2-yl)butanal |
| SMILES | CC(=O)CCCC1(C)OCCO1.CC(C=O)CCC1(C)OCCO1 |
| InChI | InChI=1S/2C9H16O3/c1-8(7-10)3-4-9(2)11-5-6-12-9;1-8(10)4-3-5-9(2)11-6-7-12-9/h7-8H,3-6H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | UJDCSOMSPQPFBV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|