C12H22Cl2O2Si — CID 101483838
[1,1-dichloro-5-(2-methyl-1,3-dioxolan-2-yl)pent-1-en-3-yl]-trimethylsilane (PubChem CID 101483838) has the molecular formula C12H22Cl2O2Si and a molecular weight of 297.30 g/mol. Its IUPAC name is [1,1-dichloro-5-(2-methyl-1,3-dioxolan-2-yl)pent-1-en-3-yl]-trimethylsilane.
| Compound Name | [1,1-dichloro-5-(2-methyl-1,3-dioxolan-2-yl)pent-1-en-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101483838 |
| Molecular Formula | C12H22Cl2O2Si |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [1,1-dichloro-5-(2-methyl-1,3-dioxolan-2-yl)pent-1-en-3-yl]-trimethylsilane |
| SMILES | CC1(CCC(C=C(Cl)Cl)[Si](C)(C)C)OCCO1 |
| InChI | InChI=1S/C12H22Cl2O2Si/c1-12(15-7-8-16-12)6-5-10(9-11(13)14)17(2,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | YHFZYWBLKIPOOH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|