C10H18O3 — CID 10559466
(E)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-en-1-ol (PubChem CID 10559466) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (E)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-en-1-ol.
| Compound Name | (E)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-en-1-ol |
|---|---|
| PubChem CID | 10559466 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (E)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pent-2-en-1-ol |
| SMILES | C/C(=C\CCC1(C)OCCO1)CO |
| InChI | InChI=1S/C10H18O3/c1-9(8-11)4-3-5-10(2)12-6-7-13-10/h4,11H,3,5-8H2,1-2H3/b9-4+ |
| InChIKey | HUMWCTNDOODSPS-RUDMXATFSA-N |
| XLogP | 1.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|