C14H22O2 — CID 10376273
(Z)-2-methyl-5-[(1R,2S,4S)-2-methyl-3-methylidene-7-oxabicyclo[2.2.1]heptan-2-yl]pent-2-en-1-ol (PubChem CID 10376273) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (Z)-2-methyl-5-[(1R,2S,4S)-2-methyl-3-methylidene-7-oxabicyclo[2.2.1]heptan-2-yl]pent-2-en-1-ol.
| Compound Name | (Z)-2-methyl-5-[(1R,2S,4S)-2-methyl-3-methylidene-7-oxabicyclo[2.2.1]heptan-2-yl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 10376273 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (Z)-2-methyl-5-[(1R,2S,4S)-2-methyl-3-methylidene-7-oxabicyclo[2.2.1]heptan-2-yl]pent-2-en-1-ol |
| SMILES | C=C1[C@@H]2CC[C@@H](O2)[C@@]1(C)CC/C=C(/C)CO |
| InChI | InChI=1S/C14H22O2/c1-10(9-15)5-4-8-14(3)11(2)12-6-7-13(14)16-12/h5,12-13,15H,2,4,6-9H2,1,3H3/b10-5-/t12-,13+,14-/m0/s1 |
| InChIKey | GAUYXECXISHCRZ-UPCWHQCGSA-N |
| XLogP | 2.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|