C31H50O — CID 160916467
(Z)-5-[(1S,3R)-2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl]-2-methylpent-2-en-1-ol;(1S,2R,4R)-2-methyl-2-[(Z)-4-methylhex-3-enyl]-3-methylidenebicyclo[2.2.1]heptane (PubChem CID 160916467) has the molecular formula C31H50O and a molecular weight of 438.74 g/mol. Its IUPAC name is (Z)-5-[(1S,3R)-2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl]-2-methylpent-2-en-1-ol;(1S,2R,4R)-2-methyl-2-[(Z)-4-methylhex-3-enyl]-3-methylidenebicyclo[2.2.1]heptane.
| Compound Name | (Z)-5-[(1S,3R)-2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl]-2-methylpent-2-en-1-ol;(1S,2R,4R)-2-methyl-2-[(Z)-4-methylhex-3-enyl]-3-methylidenebicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 160916467 |
| Molecular Formula | C31H50O |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.39 |
| IUPAC Name | (Z)-5-[(1S,3R)-2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl]-2-methylpent-2-en-1-ol;(1S,2R,4R)-2-methyl-2-[(Z)-4-methylhex-3-enyl]-3-methylidenebicyclo[2.2.1]heptane |
| SMILES | C/C(=C/CC[C@]1(C)C2CC3[C@H](C2)C31C)CO.C=C1[C@@H]2CC[C@@H](C2)[C@@]1(C)CC/C=C(/C)CC |
| InChI | InChI=1S/C16H26.C15H24O/c1-5-12(2)7-6-10-16(4)13(3)14-8-9-15(16)11-14;1-10(9-16)5-4-6-14(2)11-7-12-13(8-11)15(12,14)3/h7,14-15H,3,5-6,8-11H2,1-2,4H3;5,11-13,16H,4,6-9H2,1-3H3/b12-7-;10-5-/t14-,15+,16+;11?,12-,13?,14+,15?/m10/s1 |
| InChIKey | SRLUBYITEGBGGC-DOHLYVBUSA-N |
| XLogP | 8.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|