C12H22O3 — CID 23260524
(E)-4-methyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-4-en-1-ol (PubChem CID 23260524) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (E)-4-methyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-4-en-1-ol.
| Compound Name | (E)-4-methyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-4-en-1-ol |
|---|---|
| PubChem CID | 23260524 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (E)-4-methyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-4-en-1-ol |
| SMILES | C/C(=C\CCC1(C)OCCO1)CCCO |
| InChI | InChI=1S/C12H22O3/c1-11(6-4-8-13)5-3-7-12(2)14-9-10-15-12/h5,13H,3-4,6-10H2,1-2H3/b11-5+ |
| InChIKey | OMGWGIZODVWCJC-VZUCSPMQSA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|