C8H15NO5 — CID 13303205
4-(2-methyl-1,3-dioxolan-2-yl)-3-nitrobutan-2-ol (PubChem CID 13303205) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is 4-(2-methyl-1,3-dioxolan-2-yl)-3-nitrobutan-2-ol.
| Compound Name | 4-(2-methyl-1,3-dioxolan-2-yl)-3-nitrobutan-2-ol |
|---|---|
| PubChem CID | 13303205 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-(2-methyl-1,3-dioxolan-2-yl)-3-nitrobutan-2-ol |
| SMILES | CC(O)C(CC1(C)OCCO1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO5/c1-6(10)7(9(11)12)5-8(2)13-3-4-14-8/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | NYNPTXLJPKRWNS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|