C12H15NO5 — CID 10978132
2,2-dideuterio-1-(4-nitrophenyl)-2-[2-(trideuteriomethyl)-1,3-dioxolan-2-yl]ethanol (PubChem CID 10978132) has the molecular formula C12H15NO5 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2,2-dideuterio-1-(4-nitrophenyl)-2-[2-(trideuteriomethyl)-1,3-dioxolan-2-yl]ethanol.
| Compound Name | 2,2-dideuterio-1-(4-nitrophenyl)-2-[2-(trideuteriomethyl)-1,3-dioxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 10978132 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2,2-dideuterio-1-(4-nitrophenyl)-2-[2-(trideuteriomethyl)-1,3-dioxolan-2-yl]ethanol |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])C(O)c2ccc([N+](=O)[O-])cc2)OCCO1 |
| InChI | InChI=1S/C12H15NO5/c1-12(17-6-7-18-12)8-11(14)9-2-4-10(5-3-9)13(15)16/h2-5,11,14H,6-8H2,1H3/i1D3,8D2 |
| InChIKey | IXTPLQCGCFPWJX-QBMBECACSA-N |
| XLogP | 1.78 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|