About methane;2-methylpropane;oxetane
methane;2-methylpropane;oxetane (PubChem CID 160642963) has the molecular formula C8H20O
and a molecular weight of 132.25 g/mol. Its IUPAC name is methane;2-methylpropane;oxetane.
Molecular Properties
| Compound Name | methane;2-methylpropane;oxetane |
| PubChem CID | 160642963 |
| Molecular Formula | C8H20O |
| Molecular Weight | 132.25 g/mol |
| Exact Mass | 132.15 |
| IUPAC Name | methane;2-methylpropane;oxetane |
| SMILES | C.C1COC1.CC(C)C |
| InChI | InChI=1S/C4H10.C3H6O.CH4/c1-4(2)3;1-2-4-3-1;/h4H,1-3H3;1-3H2;1H4 |
| InChIKey | RJKOEKLPNAUSMH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;2-methylpropane;oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylpropane;oxetane?
The IUPAC name of methane;2-methylpropane;oxetane (CID 160642963) is methane;2-methylpropane;oxetane.
What is the SMILES notation for methane;2-methylpropane;oxetane?
The canonical SMILES for methane;2-methylpropane;oxetane is C.C1COC1.CC(C)C.
What is the InChIKey of methane;2-methylpropane;oxetane?
The InChIKey is RJKOEKLPNAUSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H6O.CH4/c1-4(2)3;1-2-4-3-1;/h4H,1-3H3;1-3H2;1H4.
What are the key properties of methane;2-methylpropane;oxetane?
methane;2-methylpropane;oxetane has a molecular weight of 132.25 g/mol, XLogP of 2.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylpropane;oxetane is sourced from PubChem (CID 160642963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).