About dioxane;undecanoic acid
dioxane;undecanoic acid (PubChem CID 174785577) has the molecular formula C15H30O4
and a molecular weight of 274.40 g/mol. Its IUPAC name is dioxane;undecanoic acid.
Molecular Properties
| Compound Name | dioxane;undecanoic acid |
| PubChem CID | 174785577 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | dioxane;undecanoic acid |
| SMILES | C1CCOOC1.CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C11H22O2.C4H8O2/c1-2-3-4-5-6-7-8-9-10-11(12)13;1-2-4-6-5-3-1/h2-10H2,1H3,(H,12,13);1-4H2 |
| InChIKey | NXNCTJXQJROIEY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dioxane;undecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxane;undecanoic acid?
The IUPAC name of dioxane;undecanoic acid (CID 174785577) is dioxane;undecanoic acid.
What is the SMILES notation for dioxane;undecanoic acid?
The canonical SMILES for dioxane;undecanoic acid is C1CCOOC1.CCCCCCCCCCC(=O)O.
What is the InChIKey of dioxane;undecanoic acid?
The InChIKey is NXNCTJXQJROIEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2.C4H8O2/c1-2-3-4-5-6-7-8-9-10-11(12)13;1-2-4-6-5-3-1/h2-10H2,1H3,(H,12,13);1-4H2.
What are the key properties of dioxane;undecanoic acid?
dioxane;undecanoic acid has a molecular weight of 274.40 g/mol, XLogP of 4.33, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxane;undecanoic acid is sourced from PubChem (CID 174785577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).