C17H28N2O8 — CID 59022311
N-[[3,9-dimethyl-3-[(prop-2-enoylamino)methoxy]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]oxymethyl]propanamide (PubChem CID 59022311) has the molecular formula C17H28N2O8 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[[3,9-dimethyl-3-[(prop-2-enoylamino)methoxy]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]oxymethyl]propanamide.
| Compound Name | N-[[3,9-dimethyl-3-[(prop-2-enoylamino)methoxy]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]oxymethyl]propanamide |
|---|---|
| PubChem CID | 59022311 |
| Molecular Formula | C17H28N2O8 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[[3,9-dimethyl-3-[(prop-2-enoylamino)methoxy]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]oxymethyl]propanamide |
| SMILES | C=CC(=O)NCOC1(C)OCC2(CO1)COC(C)(OCNC(=O)CC)OC2 |
| InChI | InChI=1S/C17H28N2O8/c1-5-13(20)18-11-26-15(3)22-7-17(8-23-15)9-24-16(4,25-10-17)27-12-19-14(21)6-2/h5H,1,6-12H2,2-4H3,(H,18,20)(H,19,21) |
| InChIKey | GSJCIRCQZIBKAV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|