C18H27NO7 — CID 174374068
N-(butoxymethyl)prop-2-enamide;2-methylprop-2-enoic acid;prop-2-enoyl prop-2-enoate (PubChem CID 174374068) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is N-(butoxymethyl)prop-2-enamide;2-methylprop-2-enoic acid;prop-2-enoyl prop-2-enoate.
| Compound Name | N-(butoxymethyl)prop-2-enamide;2-methylprop-2-enoic acid;prop-2-enoyl prop-2-enoate |
|---|---|
| PubChem CID | 174374068 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-(butoxymethyl)prop-2-enamide;2-methylprop-2-enoic acid;prop-2-enoyl prop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=CC(=O)NCOCCCC.C=CC(=O)OC(=O)C=C |
| InChI | InChI=1S/C8H15NO2.C6H6O3.C4H6O2/c1-3-5-6-11-7-9-8(10)4-2;1-3-5(7)9-6(8)4-2;1-3(2)4(5)6/h4H,2-3,5-7H2,1H3,(H,9,10);3-4H,1-2H2;1H2,2H3,(H,5,6) |
| InChIKey | OAGUELNXTXLBDH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|