C15H28O6 — CID 22218874
bis(2-methylprop-2-enoic acid);2-pentoxyethanol (PubChem CID 22218874) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);2-pentoxyethanol.
| Compound Name | bis(2-methylprop-2-enoic acid);2-pentoxyethanol |
|---|---|
| PubChem CID | 22218874 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);2-pentoxyethanol |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CCCCCOCCO |
| InChI | InChI=1S/C7H16O2.2C4H6O2/c1-2-3-4-6-9-7-5-8;2*1-3(2)4(5)6/h8H,2-7H2,1H3;2*1H2,2H3,(H,5,6) |
| InChIKey | PGVKAFXTXBBXBE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|