C16H32O7 — CID 88724515
1-hexoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylprop-2-enoic acid (PubChem CID 88724515) has the molecular formula C16H32O7 and a molecular weight of 336.43 g/mol. Its IUPAC name is 1-hexoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylprop-2-enoic acid.
| Compound Name | 1-hexoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 88724515 |
| Molecular Formula | C16H32O7 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1-hexoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCCCCCOC(O)COCCOCCO |
| InChI | InChI=1S/C12H26O5.C4H6O2/c1-2-3-4-5-7-17-12(14)11-16-10-9-15-8-6-13;1-3(2)4(5)6/h12-14H,2-11H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | OPLSYPDFGSIXES-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|