C14H28O7 — CID 87238952
1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylprop-2-enoic acid (PubChem CID 87238952) has the molecular formula C14H28O7 and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylprop-2-enoic acid.
| Compound Name | 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 87238952 |
| Molecular Formula | C14H28O7 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCCCOC(O)COCCOCCO |
| InChI | InChI=1S/C10H22O5.C4H6O2/c1-2-3-5-15-10(12)9-14-8-7-13-6-4-11;1-3(2)4(5)6/h10-12H,2-9H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | DNMWUXNIUIGTFM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|