C21H27NO7 — CID 11475226
ethyl 19-isocyano-2,5,8,11,14-pentaoxatricyclo[13.7.0.017,21]docosa-1(15),16,21-triene-19-carboxylate (PubChem CID 11475226) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is ethyl 19-isocyano-2,5,8,11,14-pentaoxatricyclo[13.7.0.017,21]docosa-1(15),16,21-triene-19-carboxylate.
| Compound Name | ethyl 19-isocyano-2,5,8,11,14-pentaoxatricyclo[13.7.0.017,21]docosa-1(15),16,21-triene-19-carboxylate |
|---|---|
| PubChem CID | 11475226 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | ethyl 19-isocyano-2,5,8,11,14-pentaoxatricyclo[13.7.0.017,21]docosa-1(15),16,21-triene-19-carboxylate |
| SMILES | [C-]#[N+]C1(C(=O)OCC)Cc2cc3c(cc2C1)OCCOCCOCCOCCO3 |
| InChI | InChI=1S/C21H27NO7/c1-3-27-20(23)21(22-2)14-16-12-18-19(13-17(16)15-21)29-11-9-26-7-5-24-4-6-25-8-10-28-18/h12-13H,3-11,14-15H2,1H3 |
| InChIKey | KIQIRNYJNHRDMM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|