C11H13NO4S — CID 135014114
ethyl 5-isocyano-2,2-dioxo-1,3,4,6-tetrahydrocyclopenta[c]thiophene-5-carboxylate (PubChem CID 135014114) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is ethyl 5-isocyano-2,2-dioxo-1,3,4,6-tetrahydrocyclopenta[c]thiophene-5-carboxylate.
| Compound Name | ethyl 5-isocyano-2,2-dioxo-1,3,4,6-tetrahydrocyclopenta[c]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 135014114 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | ethyl 5-isocyano-2,2-dioxo-1,3,4,6-tetrahydrocyclopenta[c]thiophene-5-carboxylate |
| SMILES | [C-]#[N+]C1(C(=O)OCC)CC2=C(C1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C11H13NO4S/c1-3-16-10(13)11(12-2)4-8-6-17(14,15)7-9(8)5-11/h3-7H2,1H3 |
| InChIKey | JXEDBQLLFQENOA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|